For research use only. Not for therapeutic Use.
Lehmannine（Cat No.:R029251）is a naturally occurring alkaloid primarily isolated from species of the Lehmannia or Narcissus genera within the Amaryllidaceae family. Structurally, it belongs to the isoquinoline or lycorine-type alkaloid group, featuring a complex polycyclic framework with nitrogen-containing rings. Lehmannine exhibits a range of biological activities, including anticholinesterase, antiviral, and potential anticancer effects. Its mechanism of action may involve enzyme inhibition and modulation of neurotransmitter pathways, making it of interest in neurodegenerative disease research. Due to its unique structure and bioactivity, lehmannine holds promise in pharmacological and medicinal chemistry studies.
| CAS Number | 58480-54-9 |
| Synonyms | (1S,2R,9S,17S)-7,13-diazatetracyclo[7.7.1.02,7.013,17]heptadec-3-en-6-one |
| Molecular Formula | C15H22N2O |
| Purity | ≥95% |
| IUPAC Name | (1S,2R,9S,17S)-7,13-diazatetracyclo[7.7.1.02,7.013,17]heptadec-3-en-6-one |
| InChI | InChI=1S/C15H22N2O/c18-14-7-1-6-13-12-5-3-9-16-8-2-4-11(15(12)16)10-17(13)14/h1,6,11-13,15H,2-5,7-10H2/t11-,12+,13+,15-/m0/s1 |
| InChIKey | WUVYENIUARJBNM-JLNYLFASSA-N |
| SMILES | C1C[C@H]2CN3[C@H](C=CCC3=O)[C@@H]4[C@H]2N(C1)CCC4 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
