For research use only. Not for therapeutic Use.
Leelamine（Cat No.:R009359）is a naturally occurring tricyclic diterpene amine derived from pine tree bark, known for its pharmacological potential in cancer research. It exhibits anticancer activity by disrupting intracellular cholesterol transport, leading to impaired receptor-mediated endocytosis and inhibition of key survival signaling pathways such as PI3K/Akt, STAT3, and MAPK. Leelamine induces apoptosis and inhibits proliferation in various cancer cell types, including melanoma and prostate cancer. Its unique mechanism of targeting cholesterol homeostasis without directly affecting DNA or microtubules makes it a promising lead compound for developing novel anticancer therapeutics.
| CAS Number | 1446-61-3 |
| Synonyms | [(1R,4aS,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]methanamine |
| Molecular Formula | C20H31N |
| Purity | ≥95% |
| IUPAC Name | [(1R,4aS,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]methanamine |
| InChI | InChI=1S/C20H31N/c1-14(2)15-6-8-17-16(12-15)7-9-18-19(3,13-21)10-5-11-20(17,18)4/h6,8,12,14,18H,5,7,9-11,13,21H2,1-4H3/t18-,19-,20+/m0/s1 |
| InChIKey | JVVXZOOGOGPDRZ-SLFFLAALSA-N |
| SMILES | CC(C)C1=CC2=C(C=C1)[C@]3(CCC[C@@]([C@@H]3CC2)(C)CN)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
