For research use only. Not for therapeutic Use.
LB244(CAT: I040719) is a synthetic peptide and a known antagonist of the leukocyte immunoglobulin-like receptor B4 (LILRB4), also referred to as ILT3. LILRB4 is an inhibitory receptor expressed on myeloid cells and plays a key role in immune tolerance and suppression, particularly within the tumor microenvironment. By blocking LILRB4, LB244 is used to explore immune checkpoint regulation and enhance anti-tumor immune responses. It holds promise in immuno-oncology research for reversing immune suppression and promoting T cell activation. LB244 is a valuable tool for studying myeloid cell biology and immune evasion mechanisms.
| Synonyms | N-[(5S)-5-(1H-benzimidazol-2-yl)-5-[(4-phenylbenzoyl)amino]pentyl]-5-nitrofuran-2-carboxamide |
| Molecular Formula | C30H27N5O5 |
| Purity | ≥95% |
| IUPAC Name | N-[(5S)-5-(1H-benzimidazol-2-yl)-5-[(4-phenylbenzoyl)amino]pentyl]-5-nitrofuran-2-carboxamide |
| InChI | InChI=1S/C30H27N5O5/c36-29(22-15-13-21(14-16-22)20-8-2-1-3-9-20)34-25(28-32-23-10-4-5-11-24(23)33-28)12-6-7-19-31-30(37)26-17-18-27(40-26)35(38)39/h1-5,8-11,13-18,25H,6-7,12,19H2,(H,31,37)(H,32,33)(H,34,36)/t25-/m0/s1 |
| InChIKey | YJTWDEBBCCREDG-VWLOTQADSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)C(=O)NC(CCCCNC(=O)C3=CC=C(O3)[N+](=O)[O-])C4=NC5=CC=CC=C5N4 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
