For research use only. Not for therapeutic Use.
Lappaol A（Cat No.:I030500）is a bioactive lignan compound isolated from Arctium lappa (greater burdock), a plant widely used in traditional medicine. It exhibits potent anticancer, anti-inflammatory, and antioxidant properties. Lappaol A has been shown to inhibit the proliferation of various cancer cell lines by inducing cell cycle arrest and apoptosis, often through the modulation of signaling pathways such as PI3K/Akt and MAPK. Additionally, it suppresses inflammatory mediators and scavenges free radicals, contributing to its protective effects. Its diverse pharmacological profile makes Lappaol A a promising candidate for drug development in oncology and inflammatory diseases.
| CAS Number | 62333-08-8 |
| Synonyms | (3R,4R)-4-[[(2S,3R)-2-(4-hydroxy-3-methoxyphenyl)-3-(hydroxymethyl)-7-methoxy-2,3-dihydro-1-benzofuran-5-yl]methyl]-3-[(4-hydroxy-3-methoxyphenyl)methyl]oxolan-2-one |
| Molecular Formula | C30H32O9 |
| Purity | ≥95% |
| IUPAC Name | (3R,4R)-4-[[(2S,3R)-2-(4-hydroxy-3-methoxyphenyl)-3-(hydroxymethyl)-7-methoxy-2,3-dihydro-1-benzofuran-5-yl]methyl]-3-[(4-hydroxy-3-methoxyphenyl)methyl]oxolan-2-one |
| InChI | InChI=1S/C30H32O9/c1-35-25-11-16(4-6-23(25)32)9-20-19(15-38-30(20)34)8-17-10-21-22(14-31)28(39-29(21)27(12-17)37-3)18-5-7-24(33)26(13-18)36-2/h4-7,10-13,19-20,22,28,31-33H,8-9,14-15H2,1-3H3/t19-,20+,22-,28+/m0/s1 |
| InChIKey | PYLYQTVVQXPBIJ-OUZJQUPYSA-N |
| SMILES | COC1=CC(=CC2=C1O[C@@H]([C@H]2CO)C3=CC(=C(C=C3)O)OC)C[C@H]4COC(=O)[C@@H]4CC5=CC(=C(C=C5)O)OC |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
