For research use only. Not for therapeutic Use.
Lansoprazole sulfide (Cat No.: R004085) is a key metabolite and synthetic intermediate of lansoprazole, a proton pump inhibitor used to treat acid-related gastrointestinal conditions. It features a benzimidazole core with a thioether linkage, lacking the sulfoxide group present in lansoprazole. Lansoprazole sulfide retains some biological activity and is often used in the study of drug metabolism and pharmacokinetics. Its structural simplification makes it useful in synthetic chemistry and pharmaceutical research focused on understanding the activation and transformation of proton pump inhibitors.
| CAS Number | 103577-40-8 |
| Synonyms | 2-[[[3-Methyl-4-(2,2,2-trifluoroethoxy)-2-pyridinyl]methyl]thio]-1H-benzimidazole;?AG 1777; H 225/18; K 1252; |
| Molecular Formula | C16H14F3N3OS |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 2-[[3-methyl-4-(2,2,2-trifluoroethoxy)pyridin-2-yl]methylsulfanyl]-1H-benzimidazole |
| InChI | InChI=1S/C16H14F3N3OS/c1-10-13(20-7-6-14(10)23-9-16(17,18)19)8-24-15-21-11-4-2-3-5-12(11)22-15/h2-7H,8-9H2,1H3,(H,21,22) |
| InChIKey | CCHLMSUZHFPSFC-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CN=C1CSC2=NC3=CC=CC=C3N2)OCC(F)(F)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |