For research use only. Not for therapeutic Use.
Lamiide（Cat No.:R061723）is a naturally derived iridoid compound found in various species of the Lamiaceae family, especially Stachys and Lamium plants. It belongs to a group of secondary metabolites known for their anti-inflammatory, neuroprotective, and antioxidant activities. Lamiide plays a potential role in traditional medicine, where plant sources containing it are used for wound healing and treating infections. Its structure, featuring a cyclopentanoid monoterpene backbone, contributes to its bioactivity. Research into lamiide suggests it may modulate immune responses and offer therapeutic value in inflammation-related disorders and oxidative stress conditions.
| CAS Number | 27856-54-8 |
| Synonyms | methyl (1S,4aR,6S,7R,7aS)-4a,6,7-trihydroxy-7-methyl-1-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,5,6,7a-tetrahydrocyclopenta[c]pyran-4-carboxylate |
| Molecular Formula | C17H26O12 |
| Purity | ≥95% |
| IUPAC Name | methyl (1S,4aR,6S,7R,7aS)-4a,6,7-trihydroxy-7-methyl-1-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,5,6,7a-tetrahydrocyclopenta[c]pyran-4-carboxylate |
| InChI | InChI=1S/C17H26O12/c1-16(24)8(19)3-17(25)6(13(23)26-2)5-27-15(12(16)17)29-14-11(22)10(21)9(20)7(4-18)28-14/h5,7-12,14-15,18-22,24-25H,3-4H2,1-2H3/t7-,8+,9-,10+,11-,12-,14+,15+,16+,17+/m1/s1 |
| InChIKey | VFYACENSDOLJGQ-SNONCDODSA-N |
| SMILES | C[C@@]1([C@H](C[C@]2([C@@H]1[C@@H](OC=C2C(=O)OC)O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O)O)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
