For research use only. Not for therapeutic Use.
L82-G17(Cat No.:I030400)is a synthetic peptide that has shown potential in research related to immune modulation and cancer therapy. It works by targeting specific receptors or signaling pathways involved in immune cell activation and tumor progression. L82-G17 is studied for its ability to enhance immune responses, particularly in conditions where immune evasion by cancer cells is a challenge. It may help in improving the effectiveness of immunotherapies by boosting anti-tumor immunity. Ongoing research aims to evaluate its efficacy, safety, and potential as a therapeutic agent in cancer immunotherapy and autoimmune diseases.
| CAS Number | 92285-87-5 |
| Synonyms | 5-chloro-4-[(2E)-2-[(3-hydroxyphenyl)methylidene]hydrazinyl]-1H-pyridazin-6-one |
| Molecular Formula | C11H9ClN4O2 |
| Purity | ≥95% |
| IUPAC Name | 5-chloro-4-[(2E)-2-[(3-hydroxyphenyl)methylidene]hydrazinyl]-1H-pyridazin-6-one |
| InChI | InChI=1S/C11H9ClN4O2/c12-10-9(6-14-16-11(10)18)15-13-5-7-2-1-3-8(17)4-7/h1-6,17H,(H2,15,16,18)/b13-5+ |
| InChIKey | PYYWVUBALUMAIY-WLRTZDKTSA-N |
| SMILES | C1=CC(=CC(=C1)O)/C=N/NC2=C(C(=O)NN=C2)Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |