For research use only. Not for therapeutic Use.
L-Valine-13C5,15N(Cat No.:S000646) is a doubly stable isotope-labeled form of the essential amino acid valine, where five carbon atoms are replaced with carbon-13 (13C) and the nitrogen atom is replaced with nitrogen-15 (15N). This specialized labeling is highly beneficial for advanced scientific research, particularly in mass spectrometry and nuclear magnetic resonance (NMR) spectroscopy. It allows for detailed tracing and analysis of valine’s metabolic pathways, providing insights into protein synthesis and nitrogen metabolism in biological systems. This dual labeling is crucial for understanding complex biochemical processes and enhancing metabolic research studies.
CAS Number | 202407-30-5 |
Molecular Formula | 13C5H1115NO2 |
Purity | ≥95% |
Target | Endogenous Metabolite |
IUPAC Name | (2S)-2-(15N)azanyl-3-(113C)methyl(1,2,3,4-13C4)butanoic acid |
InChI | InChI=1S/C5H11NO2/c1-3(2)4(6)5(7)8/h3-4H,6H2,1-2H3,(H,7,8)/t4-/m0/s1/i1+1,2+1,3+1,4+1,5+1,6+1 |
InChIKey | KZSNJWFQEVHDMF-XAFSXMPTSA-N |
SMILES | CC(C)C(C(=O)O)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |