L-Tryptophan-1-13C (CAT: C000354) is an isotope-labeled variant of L-Tryptophan, an essential amino acid with vital biological functions. This specific isotope labeling involves the incorporation of a carbon-13 atom at position 1 of the tryptophan molecule. Isotope-labeled compounds like L-Tryptophan-1-13C are extensively used in biochemical and metabolic studies, especially in nuclear magnetic resonance (NMR) spectroscopy and mass spectrometry. They allow researchers to track the metabolic pathways and interactions of the amino acids within biological systems.
Catalog Number | C000354 |
CAS Number | 81201-92-5 |
Molecular Formula | C₁₀¹³CH₁₂N₂O₂ |
Purity | ≥95% |
Solubility | Aqueous Base (Slightly), DMSO (Slightly), Methanol (Slightly) |
Appearance | White to Light Brown Solid |
Storage | 4°C, Hygroscopic |
IUPAC Name | (2S)-2-amino-3-(1H-indol-3-yl)(113C)propanoic acid |
InChI | InChI=1S/C11H12N2O2/c12-9(11(14)15)5-7-6-13-10-4-2-1-3-8(7)10/h1-4,6,9,13H,5,12H2,(H,14,15)/t9-/m0/s1/i11+1 |
InChIKey | QIVBCDIJIAJPQS-KYURPWGOSA-N |
SMILES | C1=CC=C2C(=C1)C(=CN2)C[C@@H]([13C](=O)O)N |