For research use only. Not for therapeutic Use.
L-Threonine-15N(Cat No.:S000641) is a labeled form of L-threonine where the nitrogen atom is enriched with nitrogen-15, enhancing its detectability in analytical methods such as NMR spectroscopy and mass spectrometry. L-Threonine is an essential amino acid important for protein synthesis and a precursor in the biosynthesis of glycine and serine. The 15N enrichment allows for precise tracking and analysis of threonine’s metabolic pathways and its incorporation into proteins, providing deeper insights into its role in various biological processes, including immune function and gut health, and enhancing the understanding of nitrogen metabolism in organisms.
CAS Number | 80681-09-0 |
Molecular Formula | C4H915NO3 |
Purity | ≥95% |
Target | Endogenous Metabolite |
IUPAC Name | (2S,3R)-2-(15N)azanyl-3-hydroxybutanoic acid |
InChI | InChI=1S/C4H9NO3/c1-2(6)3(5)4(7)8/h2-3,6H,5H2,1H3,(H,7,8)/t2-,3+/m1/s1/i5+1 |
InChIKey | AYFVYJQAPQTCCC-SZEKAKMSSA-N |
SMILES | CC(C(C(=O)O)N)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |