For research use only. Not for therapeutic Use.
L-Serine-d3(Cat No.:S000581) is a specialized form of serine, a non-essential amino acid crucial for protein synthesis and various metabolic processes. The “d3” designation indicates that three hydrogen atoms in the serine molecule are replaced with deuterium, a stable isotope of hydrogen. This isotopic labeling enables precise tracking of serine metabolism and its incorporation into proteins and other biomolecules using advanced analytical techniques like mass spectrometry and nuclear magnetic resonance spectroscopy. L-Serine-d3 serves as a valuable tool in metabolic studies, aiding in elucidating pathways, understanding cellular physiology, and investigating disorders related to serine metabolism, such as serine deficiency disorders.
CAS Number | 105591-10-4 |
Molecular Formula | C3H4D3NO3 |
Purity | ≥95% |
Target | Endogenous Metabolite |
IUPAC Name | (2S)-2-amino-2,3,3-trideuterio-3-hydroxypropanoic acid |
InChI | InChI=1S/C3H7NO3/c4-2(1-5)3(6)7/h2,5H,1,4H2,(H,6,7)/t2-/m0/s1/i1D2,2D |
InChIKey | MTCFGRXMJLQNBG-RBXBQAPRSA-N |
SMILES | C(C(C(=O)O)N)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |