For research use only. Not for therapeutic Use.
L-Prolyl-L-leucine(Cat No.:I043138)is a dipeptide composed of the amino acids proline and leucine, linked by a peptide bond. The proline residue is at the N-terminus, followed by leucine at the C-terminus. This compound is of interest in peptide chemistry and biochemistry, as proline plays a critical role in stabilizing peptide structures due to its unique cyclic structure. L-Prolyl-L-leucine can be used in studies of protein folding, enzyme activity, and receptor interactions. It may also have applications in the design of bioactive peptides, contributing to research in metabolic disorders and drug development.
| CAS Number | 52899-07-7 |
| Synonyms | (2S)-4-methyl-2-[[(2S)-pyrrolidine-2-carbonyl]amino]pentanoic acid |
| Molecular Formula | C11H20N2O3 |
| Purity | ≥95% |
| IUPAC Name | (2S)-4-methyl-2-[[(2S)-pyrrolidine-2-carbonyl]amino]pentanoic acid |
| InChI | InChI=1S/C11H20N2O3/c1-7(2)6-9(11(15)16)13-10(14)8-4-3-5-12-8/h7-9,12H,3-6H2,1-2H3,(H,13,14)(H,15,16)/t8-,9-/m0/s1 |
| InChIKey | ZKQOUHVVXABNDG-IUCAKERBSA-N |
| SMILES | CC(C)C[C@@H](C(=O)O)NC(=O)[C@@H]1CCCN1 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |