For research use only. Not for therapeutic Use.
L-Phenylalanylglycylglycine（Cat No.:I043143）is a tripeptide composed of phenylalanine, glycine, and glycine. It consists of a phenylalanine residue at the N-terminus, followed by two glycine molecules at the C-terminus. This compound is of interest in peptide chemistry and biochemistry for its role in protein synthesis and potential bioactivity. It may be used in studies examining peptide interactions, enzyme activity, and receptor binding. L-Phenylalanylglycylglycine can also serve as a model compound for exploring the effects of amino acid sequence modifications on peptide stability, structure, and function in therapeutic and research applications.
| CAS Number | 23576-42-3 |
| Synonyms | 2-[[2-[[(2S)-2-amino-3-phenylpropanoyl]amino]acetyl]amino]acetic acid |
| Molecular Formula | C13H17N3O4 |
| Purity | ≥95% |
| IUPAC Name | 2-[[2-[[(2S)-2-amino-3-phenylpropanoyl]amino]acetyl]amino]acetic acid |
| InChI | InChI=1S/C13H17N3O4/c14-10(6-9-4-2-1-3-5-9)13(20)16-7-11(17)15-8-12(18)19/h1-5,10H,6-8,14H2,(H,15,17)(H,16,20)(H,18,19)/t10-/m0/s1 |
| InChIKey | NAXPHWZXEXNDIW-JTQLQIEISA-N |
| SMILES | C1=CC=C(C=C1)C[C@@H](C(=O)NCC(=O)NCC(=O)O)N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
