For research use only. Not for therapeutic Use.
L-Phenylalanine-d7 is a deuterated form of the essential amino acid L-phenylalanine, where seven hydrogen atoms are replaced with deuterium. This isotopic labeling makes it particularly useful in metabolic studies, allowing researchers to track the amino acid’s role in various biochemical pathways with enhanced precision. The deuterium atoms enable precise detection using mass spectrometry and NMR spectroscopy, facilitating studies on protein synthesis, metabolism, and related processes. Despite the isotopic modification, L-Phenylalanine-d7 retains the same chemical and biological properties as the non-labeled form, making it valuable for research in biochemistry and molecular biology.
CAS Number | 69113-60-6 |
Synonyms | (2S)-2-Amino-3-phenylpropanoic Acid-d7; (S)-(-)-Phenylalanine-d7; (S)-α-Amino-β-phenylpropionic Acid-d7; (S)-α-Aminohydrocinnamic Acid-d7; (S)-α-Amino-benzenepropanoic Acid-d7; |
Molecular Formula | C9H11NO2 |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | (2S)-2-amino-3,3-dideuterio-3-(2,3,4,5,6-pentadeuteriophenyl)propanoic acid |
InChI | InChI=1S/C9H11NO2/c10-8(9(11)12)6-7-4-2-1-3-5-7/h1-5,8H,6,10H2,(H,11,12)/t8-/m0/s1/i1D,2D,3D,4D,5D,6D2 |
InChIKey | COLNVLDHVKWLRT-RKWKZIRYSA-N |
SMILES | C1=CC=C(C=C1)CC(C(=O)O)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |