For research use only. Not for therapeutic Use.
L-Methionine sulfoxide(CAT: R000504) is the oxidized form of the essential amino acid L-methionine, produced through the action of reactive oxygen species (ROS) or enzymatic oxidation. It exists as a reversible oxidative modification that plays a critical role in regulating protein structure, redox balance, and cellular defense mechanisms. L-Methionine sulfoxide is a substrate for methionine sulfoxide reductases (MsrA and MsrB), key enzymes involved in oxidative damage repair and protein quality control. It is widely used in studies of oxidative stress, aging, neurodegeneration, and redox biology, serving as a biochemical marker and research tool for investigating protein oxidation and cellular stress responses.
| CAS Number | 3226-65-1 |
| Synonyms | (2S)-2-amino-4-methylsulfinylbutanoic acid |
| Molecular Formula | C5H11NO3S |
| Purity | ≥95% |
| IUPAC Name | (2S)-2-amino-4-methylsulfinylbutanoic acid |
| InChI | InChI=1S/C5H11NO3S/c1-10(9)3-2-4(6)5(7)8/h4H,2-3,6H2,1H3,(H,7,8)/t4-,10?/m0/s1 |
| InChIKey | QEFRNWWLZKMPFJ-YGVKFDHGSA-N |
| SMILES | CS(=O)CCC(C(=O)O)N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
