L-Lysine(CAT: R051400) s an essential amino acid that is important for protein synthesis and plays a vital role in many physiological functions in the body. L-Lysine is found in many food sources, including meat, fish, dairy products, and legumes. L-Lysine supplements are commonly used to help prevent and treat cold sores caused by the herpes simplex virus. L-Lysine is also believed to have immune-enhancing properties and has been studied for its potential role in reducing anxiety and improving cognitive function.
| Catalog Number | R051400 |
| CAS Number | 56-87-1 |
| Synonyms | H-Lys-OH; (+)-S-Lysine; (S)-2,6-Diaminohexanoic Acid; (S)-Lysine; (S)-α,ε-Diaminocaproic Acid; Aminutrin; Biolys; (S)- 2,6-diamino-Hexanoic Acid; L-(+)-Lysine; L-2,6-Diaminocaproic Acid; L-Lys; 6-Amino-L-norleucine; Lysine; Lysine Acid; Malandil; α-L |
| Molecular Formula | C6H14N2O2 |
| Purity | 95% |
| Storage | 3 years -20C powder |
| IUPAC Name | (2S)-2,6-diaminohexanoic acid |
| InChI | InChI=1S/C6H14N2O2/c7-4-2-1-3-5(8)6(9)10/h5H,1-4,7-8H2,(H,9,10)/t5-/m0/s1 |
| InChIKey | KDXKERNSBIXSRK-YFKPBYRVSA-N |
| SMILES | C(CCN)CC(C(=O)O)N |
| Reference | <p> |
