For research use only. Not for therapeutic Use.
L-Isoleucine-13C6(Cat No.:S000631) is a stable isotope-labeled form of the essential amino acid isoleucine, where all six carbon atoms are enriched with carbon-13 (13C). This labeling facilitates the detailed analysis of isoleucine’s metabolic pathways using mass spectrometry and nuclear magnetic resonance (NMR) spectroscopy. L-Isoleucine-13C6 is particularly useful in studying protein synthesis and energy metabolism, as isoleucine plays a critical role in muscle repair and growth. This labeled amino acid helps researchers explore how isoleucine is metabolized in the body, contributing to a better understanding of nutritional dynamics and metabolic disorders.
| CAS Number | 201740-82-1 |
| Molecular Formula | 13C6H13NO2 |
| Purity | ≥95% |
| IUPAC Name | (2S,3S)-2-amino-3-(113C)methyl(1,2,3,4,5-13C5)pentanoic acid |
| InChI | InChI=1S/C6H13NO2/c1-3-4(2)5(7)6(8)9/h4-5H,3,7H2,1-2H3,(H,8,9)/t4-,5-/m0/s1/i1+1,2+1,3+1,4+1,5+1,6+1 |
| InChIKey | AGPKZVBTJJNPAG-CPLGCGHPSA-N |
| SMILES | CCC(C)C(C(=O)O)N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |