For research use only. Not for therapeutic Use.
L-Galactose is a biochemical reagent that can be used as a biological material or organic compound for life science related research.
| CAS Number | 15572-79-9 |
| Synonyms | (2S,3R,4R,5S)-2,3,4,5,6-pentahydroxyhexanal |
| Molecular Formula | C6H12O6 |
| Purity | ≥95% |
| InChI | InChI=1S/C6H12O6/c7-1-3(9)5(11)6(12)4(10)2-8/h1,3-6,8-12H,2H2/t3-,4+,5+,6-/m1/s1 |
| InChIKey | GZCGUPFRVQAUEE-DPYQTVNSSA-N |
| SMILES | C(C(C(C(C(C=O)O)O)O)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |