For research use only. Not for therapeutic Use.
L-Ethionine(CAT: R002318) is a non-proteinogenic analog of the essential amino acid methionine, featuring an ethyl group in place of the methyl group. It functions as a metabolic antagonist, disrupting normal methionine metabolism and methylation processes. Commonly used in research, L-ethionine is employed to induce liver injury, hepatocarcinogenesis, and to study methylation-dependent cellular mechanisms. Its ability to interfere with S-adenosylmethionine (SAM) synthesis makes it a valuable tool in cancer, epigenetics, and toxicology studies. L-Ethionine is particularly relevant in modeling liver diseases and understanding aberrant methylation in disease progression.
| CAS Number | 13073-35-3 |
| Synonyms | (2S)-2-amino-4-ethylsulfanylbutanoic acid |
| Molecular Formula | C6H13NO2S |
| Purity | ≥95% |
| IUPAC Name | (2S)-2-amino-4-ethylsulfanylbutanoic acid |
| InChI | InChI=1S/C6H13NO2S/c1-2-10-4-3-5(7)6(8)9/h5H,2-4,7H2,1H3,(H,8,9)/t5-/m0/s1 |
| InChIKey | GGLZPLKKBSSKCX-YFKPBYRVSA-N |
| SMILES | CCSCC[C@@H](C(=O)O)N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
