For research use only. Not for therapeutic Use.
L-DOPA (CAT: A000350) is a naturally occurring amino acid precursor to the neurotransmitters dopamine, norepinephrine, and epinephrine. Clinically, it is best known for its use in the treatment of Parkinson’s disease and dopamine-responsive dystonia, where it replenishes deficient dopamine levels in the brain. L-DOPA crosses the blood-brain barrier and is often administered with dopa decarboxylase inhibitors (e.g., carbidopa) to prevent premature peripheral conversion. In research, L-DOPA is also used in neurobiology, biochemistry, and pharmacology to study catecholamine pathways. As a chiral, non-proteinogenic amino acid, it plays an essential role in both therapeutic applications and neuroscience investigations.
| CAS Number | 59-92-7 |
| Synonyms | (2S)-2-amino-3-(3,4-dihydroxyphenyl)propanoic acid |
| Purity | ≥95% |
| IUPAC Name | (2S)-2-amino-3-(3,4-dihydroxyphenyl)propanoic acid |
| InChI | InChI=1S/C9H11NO4/c10-6(9(13)14)3-5-1-2-7(11)8(12)4-5/h1-2,4,6,11-12H,3,10H2,(H,13,14)/t6-/m0/s1 |
| InChIKey | WTDRDQBEARUVNC-LURJTMIESA-N |
| SMILES | C1=CC(=C(C=C1CC(C(=O)O)N)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
