For research use only. Not for therapeutic Use.
L-Diguluronic acid disodium(Cat No.:I042268)is a disodium salt derivative of L-diguluronic acid, a sugar component found in certain polysaccharides, particularly in alginates. It plays a role in the structural integrity and properties of algal cell walls. As a compound, L-Diguluronic acid disodium is studied for its potential applications in biomedical and pharmaceutical fields. Its unique chemical structure may contribute to its ability to form gels and interact with biological tissues, making it useful in drug delivery systems, wound healing, and tissue engineering. Its properties are being explored for therapeutic use in various medical applications.
CAS Number | 1883438-76-3 |
Synonyms | disodium;(2R,3S,4S,5S,6R)-6-[(2R,3S,4R,5S,6R)-2-carboxylato-4,5,6-trihydroxyoxan-3-yl]oxy-3,4,5-trihydroxyoxane-2-carboxylate |
Molecular Formula | C12H16Na2O13 |
Purity | ≥95% |
IUPAC Name | disodium;(2R,3S,4S,5S,6R)-6-[(2R,3S,4R,5S,6R)-2-carboxylato-4,5,6-trihydroxyoxan-3-yl]oxy-3,4,5-trihydroxyoxane-2-carboxylate |
InChI | InChI=1S/C12H18O13.2Na/c13-1-2(14)7(9(18)19)25-12(5(1)17)24-6-3(15)4(16)11(22)23-8(6)10(20)21;;/h1-8,11-17,22H,(H,18,19)(H,20,21);;/q;2*+1/p-2/t1-,2-,3+,4-,5-,6-,7+,8+,11+,12+;;/m0../s1 |
InChIKey | NTIXLLFKQPXXAX-HXWROTKTSA-L |
SMILES | [C@@H]1([C@@H]([C@@H](O[C@H]([C@H]1O)O[C@H]2[C@@H]([C@@H]([C@@H](O[C@H]2C(=O)[O-])O)O)O)C(=O)[O-])O)O.[Na+].[Na+] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |