For research use only. Not for therapeutic Use.
L-Citrulline-d4(Cat No.:S000623) is a deuterium-labeled version of the amino acid citrulline, where four hydrogen atoms are replaced with deuterium (D), the heavier isotope of hydrogen. This labeling enhances the stability and detection of citrulline in scientific investigations, particularly in mass spectrometry and nuclear magnetic resonance (NMR) spectroscopy. Citrulline plays a crucial role in the urea cycle, which helps eliminate ammonia from the body, and is also important in nitric oxide synthesis, which affects blood flow and cardiovascular health. L-Citrulline-d4 is valuable for studying these physiological pathways and understanding citrulline’s therapeutic potential.
| CAS Number | 1217474-00-4 |
| Molecular Formula | C6H9D4N3O3 |
| Purity | ≥95% |
| Target | Endogenous Metabolite |
| IUPAC Name | (2S)-2-amino-5-(carbamoylamino)-4,4,5,5-tetradeuteriopentanoic acid |
| InChI | InChI=1S/C6H13N3O3/c7-4(5(10)11)2-1-3-9-6(8)12/h4H,1-3,7H2,(H,10,11)(H3,8,9,12)/t4-/m0/s1/i1D2,3D2 |
| InChIKey | RHGKLRLOHDJJDR-KKOAYFQZSA-N |
| SMILES | C(CC(C(=O)O)N)CNC(=O)N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |