L-Aspartic Acid-15N（Cat No.:R032539） is an isotopically labeled form of L-aspartic acid, where the nitrogen atom is enriched with the stable isotope 15N. This modification enhances its utility in nitrogen metabolism studies, allowing for precise tracking and analysis of nitrogen utilization and synthesis pathways in biological systems. Particularly valuable in proteomics and enzyme research, L-Aspartic Acid-15N aids in elucidating protein structure and function. It is essential for researchers investigating amino acid biosynthesis, protein turnover, and related metabolic processes, providing deeper insights into fundamental biological mechanisms.
| Catalog Number | R032539 |
| CAS Number | 3715-16-0 |
| Synonyms | (S)-2-Aminobutanedioic Acid-15N; (S)-Aminobutanedioic Acid-15N; L-(+)-Aspartic Acid-15N; L-Aminosuccinic Acid-15N; L-Asparagic Acid-15N; L-Asparaginic Acid-15N; NSC 3973-15N; NSC 79553-15N |
| Molecular Formula | C4H7NO4 |
| Purity | 95% |
| Storage | -20°C |
| IUPAC Name | (2S)-2-(15N)azanylbutanedioic acid |
| InChI | InChI=1S/C4H7NO4/c5-2(4(8)9)1-3(6)7/h2H,1,5H2,(H,6,7)(H,8,9)/t2-/m0/s1/i5+1 |
| InChIKey | CKLJMWTZIZZHCS-KPHKZEKTSA-N |
| SMILES | C([C@@H](C(=O)O)[15NH2])C(=O)O |
