For research use only. Not for therapeutic Use.
L-Asparagine monohydrate(CAT: R015724) is a naturally occurring amino acid and a key building block of proteins, supplied in its stable hydrated crystalline form. As an essential nutrient for cell culture, it supports protein and nucleotide biosynthesis, making it widely used in biochemistry, molecular biology, and microbiology research. L-Asparagine plays a critical role in metabolic pathways, nitrogen balance, and glycoprotein synthesis. It is also employed in cancer metabolism studies, given its link to asparagine dependency in certain tumor cells. L-Asparagine monohydrate is a versatile reagent for cell culture media preparation, biochemical assays, nutritional studies, and pharmaceutical or biotechnological applications.
| CAS Number | 5794-13-8 |
| Synonyms | (2S)-2,4-diamino-4-oxobutanoic acid;hydrate |
| Molecular Formula | C4H10N2O4 |
| Purity | ≥95% |
| IUPAC Name | (2S)-2,4-diamino-4-oxobutanoic acid;hydrate |
| InChI | InChI=1S/C4H8N2O3.H2O/c5-2(4(8)9)1-3(6)7;/h2H,1,5H2,(H2,6,7)(H,8,9);1H2/t2-;/m0./s1 |
| InChIKey | RBMGJIZCEWRQES-DKWTVANSSA-N |
| SMILES | C(C(C(=O)O)N)C(=O)N.O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
