L-AP6 (CAT: I010195) is an antagonist of the excitatory amino acid transporter subtype 3 (EAAT3), also known as glutamate transporter 1 (GLT-1). EAAT3 is a sodium-dependent transporter responsible for the reuptake of glutamate, an important neurotransmitter in the central nervous system. By inhibiting EAAT3, L-AP6 can interfere with glutamate reuptake, leading to increased extracellular levels of glutamate. This modulation of glutamate transport can have significant implications in neurobiological processes and neurodegenerative disorders. L-AP6 is commonly used in research to study the roles of glutamate transporters and glutamate signaling in various physiological and pathological conditions.
Catalog Number | I010195 |
CAS Number | 78944-89-5 |
Synonyms | L-(+)-2-Amino-6-phosphonohexanoic acid |
Molecular Formula | C6H14NO5P |
Purity | 95% |
Target | GluR |
Solubility | Soluble to 100 mM in 1eq. NaOH |
Storage | Store at RT |
IUPAC Name | 2-amino-6-phosphonohexanoic acid |
InChI | InChI=1S/C6H14NO5P/c7-5(6(8)9)3-1-2-4-13(10,11)12/h5H,1-4,7H2,(H,8,9)(H2,10,11,12) |
InChIKey | QIOXWRQXHFVNLV-UHFFFAOYSA-N |
SMILES | C(CCP(=O)(O)O)CC(C(=O)O)N |