For research use only. Not for therapeutic Use.
L-Alanyl-L-leucine（Cat No.:I015086）is a dipeptide composed of the amino acids alanine and leucine, commonly studied in peptide transport and metabolism research. It serves as a model substrate for peptide transporters such as PEPT1 and PEPT2, which play essential roles in nutrient absorption and drug delivery. Researchers use L-Alanyl-L-leucine to investigate dipeptide uptake, stability, and hydrolysis, as well as its potential application in prodrug design. Its simplicity and biological relevance make it a valuable tool in biochemistry, pharmacology, and metabolic disease research focusing on peptide transport mechanisms.
| CAS Number | 3303-34-2 |
| Synonyms | (2S)-2-[[(2S)-2-aminopropanoyl]amino]-4-methylpentanoic acid |
| Molecular Formula | C9H18N2O3 |
| Purity | ≥95% |
| IUPAC Name | (2S)-2-[[(2S)-2-aminopropanoyl]amino]-4-methylpentanoic acid |
| InChI | InChI=1S/C9H18N2O3/c1-5(2)4-7(9(13)14)11-8(12)6(3)10/h5-7H,4,10H2,1-3H3,(H,11,12)(H,13,14)/t6-,7-/m0/s1 |
| InChIKey | RDIKFPRVLJLMER-BQBZGAKWSA-N |
| SMILES | C[C@@H](C(=O)N[C@@H](CC(C)C)C(=O)O)N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
