Home
>
Reference Standards> (2-(((1-Chloroethoxy)carbonyl)(methyl)amino)pyridin-3-yl)methyl 2-((tert-butoxycarbonyl)(methyl)amino)acetate
For research use only. Not for therapeutic Use.
(2-(((1-Chloroethoxy)carbonyl)(methyl)amino)pyridin-3-yl)methyl 2-((tert-butoxycarbonyl)(methyl)amino)acetate(Cat No.:R072888)is a synthetically engineered molecule featuring protective carbamate groups such as 1-chloroethoxycarbonyl and tert-butoxycarbonyl (Boc), often used in peptide and medicinal chemistry. Structurally, it combines a pyridine core with esterified and N-methylated amino functionalities, offering sites for selective reaction and molecular modification. It serves as an intermediate in the synthesis of complex bioactive compounds, aiding in controlled functional group transformations. Its reactive sites require moisture-free, inert conditions for stability. Proper storage and handling with protective equipment are essential due to potential reactivity and the presence of halogenated and carbamate moieties.
| CAS Number | 338990-31-1 |
| Molecular Formula | C18H26ClN3O6 |
| Purity | ≥95% |
| IUPAC Name | [2-[1-chloroethoxycarbonyl(methyl)amino]pyridin-3-yl]methyl 2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]acetate |
| InChI | InChI=1S/C18H26ClN3O6/c1-12(19)27-17(25)22(6)15-13(8-7-9-20-15)11-26-14(23)10-21(5)16(24)28-18(2,3)4/h7-9,12H,10-11H2,1-6H3 |
| InChIKey | KXWGVTDANRDXRN-UHFFFAOYSA-N |
| SMILES | CC(OC(=O)N(C)C1=C(C=CC=N1)COC(=O)CN(C)C(=O)OC(C)(C)C)Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |