For research use only. Not for therapeutic Use.
KX2-361(CAT: I007544) (also known as KX-02) is a dual inhibitor targeting Src kinase and tubulin polymerization, designed for anti-cancer applications. It demonstrates strong oral bioavailability and effectively crosses the blood-brain barrier (BBB) in mice, making it particularly suitable for central nervous system (CNS) tumors. KX2-361 exhibits potent anti-tumor activity, notably against glioblastoma (GBM), by disrupting microtubule dynamics and Src-mediated signaling pathways. This dual mechanism induces apoptosis in GBM cells and suppresses tumor growth. Its unique pharmacokinetic and pharmacodynamic properties make KX2-361 a promising candidate for the development of targeted therapies in aggressive brain cancers and other solid tumors.
| CAS Number | 897016-26-1 |
| Synonyms | N-[(3-fluorophenyl)methyl]-2-[5-(4-morpholin-4-ylphenyl)pyridin-2-yl]acetamide |
| Molecular Formula | C24H24FN3O2 |
| Purity | ≥95% |
| IUPAC Name | N-[(3-fluorophenyl)methyl]-2-[5-(4-morpholin-4-ylphenyl)pyridin-2-yl]acetamide |
| InChI | InChI=1S/C24H24FN3O2/c25-21-3-1-2-18(14-21)16-27-24(29)15-22-7-4-20(17-26-22)19-5-8-23(9-6-19)28-10-12-30-13-11-28/h1-9,14,17H,10-13,15-16H2,(H,27,29) |
| InChIKey | CMKKPJNMYLOUCE-UHFFFAOYSA-N |
| SMILES | C1COCCN1C2=CC=C(C=C2)C3=CN=C(C=C3)CC(=O)NCC4=CC(=CC=C4)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
