KVA-D-88 (Cat No.:I030208) is a small molecule inhibitor that specifically targets the NLRP3 inflammasome, an important component of the immune system involved in inflammatory responses. By inhibiting the activation of the NLRP3 inflammasome, KVA-D-88 has the potential to suppress the release of pro-inflammatory cytokines and alleviate inflammation. This compound holds promise as a therapeutic agent for the treatment of various inflammatory diseases.
| Catalog Number | I030208 |
| CAS Number | 2410550-31-9 |
| Synonyms | KVA-D-88; KVA-D 88; KVA-D88; KVAD-88; KVA D-88; KVAD88; KVA D 88; |
| Molecular Formula | C17H11Cl2F2N3O |
| Purity | 98% |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Storage | Store at -20°C |
| IUPAC Name | [1-(3,4-dichlorophenyl)pyrrolo[2,3-b]pyridin-2-yl]-(3,3-difluoroazetidin-1-yl)methanone |
| InChI | InChI=1S/C17H11Cl2F2N3O/c18-12-4-3-11(7-13(12)19)24-14(6-10-2-1-5-22-15(10)24)16(25)23-8-17(20,21)9-23/h1-7H,8-9H2 |
| InChIKey | JQEUSIGJVMRCOL-UHFFFAOYSA-N |
| SMILES | C1C(CN1C(=O)C2=CC3=C(N2C4=CC(=C(C=C4)Cl)Cl)N=CC=C3)(F)F |
| Reference | 1: Burkovetskaya ME, Liu Q, Vadukoot AK, Gautam N, Alnouti Y, Kumar S, Miczek K, Buch S, Hopkins CR, Guo M. KVA-D-88, a Novel Preferable Phosphodiesterase 4B Inhibitor, Decreases Cocaine-Mediated Reward Properties in Vivo. ACS Chem Neurosci. 2020 Jul 17. doi: 10.1021/acschemneuro.0c00170. Epub ahead of print. PMID: 32609488. |
