For research use only. Not for therapeutic Use.
Kulactone（Cat No.:I044797）is a naturally occurring triterpenoid compound isolated from plants such as Euphorbia and Aegle marmelos, both known for their roles in traditional medicine. Structurally related to limonoids, kulactone exhibits various biological activities, including anti-inflammatory, antimicrobial, and potential anticancer effects. It is known to modulate signaling pathways involved in inflammation and oxidative stress, making it a candidate for therapeutic research. Kulactone has also been explored for hepatoprotective and immunomodulatory properties. Its complex structure and pharmacological profile make it an important molecule in the study of bioactive natural products and drug discovery.
| CAS Number | 22611-36-5 |
| Synonyms | (2S,4S,7R,8S,9S,12R,13R,18R)-2,9,13,17,17-pentamethyl-7-(4-methylpent-3-enyl)-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-1(20)-ene-6,16-dione |
| Molecular Formula | C30H44O3 |
| Purity | ≥95% |
| IUPAC Name | (2S,4S,7R,8S,9S,12R,13R,18R)-2,9,13,17,17-pentamethyl-7-(4-methylpent-3-enyl)-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-1(20)-ene-6,16-dione |
| InChI | InChI=1S/C30H44O3/c1-18(2)9-8-10-19-25-22(33-26(19)32)17-30(7)21-11-12-23-27(3,4)24(31)14-15-28(23,5)20(21)13-16-29(25,30)6/h9,11,19-20,22-23,25H,8,10,12-17H2,1-7H3/t19-,20+,22+,23+,25-,28-,29+,30-/m1/s1 |
| InChIKey | ZIVZDNPCRURPNL-QCWHEMHRSA-N |
| SMILES | CC(=CCC[C@@H]1[C@@H]2[C@H](C[C@]3([C@]2(CC[C@H]4C3=CC[C@@H]5[C@@]4(CCC(=O)C5(C)C)C)C)C)OC1=O)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
