For research use only. Not for therapeutic Use.
KTX-951（Cat No.:I042631）is a small molecule inhibitor developed to target specific kinases involved in cancer cell signaling, particularly in the context of tumor growth and survival. It has shown promise in preclinical studies for its ability to inhibit key pathways that drive the proliferation and metastasis of cancer cells. KTX-951 aims to disrupt cellular processes essential for tumor development, making it a potential therapeutic candidate for various cancers. Research is ongoing to evaluate its safety, efficacy, and pharmacokinetic profile, with a focus on advancing it as a targeted cancer therapy.
| CAS Number | 2573298-36-7 |
| Synonyms | 6-(1,1-difluoroethyl)-N-[2-[4-[[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethyl]-7-azaspiro[3.5]nonan-7-yl]methyl]cyclohexyl]-6-methoxyindazol-5-yl]pyridine-2-carboxamide |
| Molecular Formula | C46H52F2N8O6 |
| Purity | ≥95% |
| IUPAC Name | 6-(1,1-difluoroethyl)-N-[2-[4-[[2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]ethyl]-7-azaspiro[3.5]nonan-7-yl]methyl]cyclohexyl]-6-methoxyindazol-5-yl]pyridine-2-carboxamide |
| InChI | InChI=1S/C46H52F2N8O6/c1-45(47,48)38-8-4-7-33(50-38)41(58)51-35-21-29-26-55(53-34(29)22-37(35)62-2)30-11-9-27(10-12-30)25-54-19-16-46(17-20-54)23-28(24-46)15-18-49-32-6-3-5-31-40(32)44(61)56(43(31)60)36-13-14-39(57)52-42(36)59/h3-8,21-22,26-28,30,36,49H,9-20,23-25H2,1-2H3,(H,51,58)(H,52,57,59) |
| InChIKey | XMUGELSEEJWFAK-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=CC(=N1)C(=O)NC2=CC3=CN(N=C3C=C2OC)C4CCC(CC4)CN5CCC6(CC5)CC(C6)CCNC7=CC=CC8=C7C(=O)N(C8=O)C9CCC(=O)NC9=O)(F)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
