For research use only. Not for therapeutic Use.
KSQ-4279（Cat No.:I045127）is an investigational small-molecule inhibitor of poly (ADP-ribose) glycohydrolase (PARG), a key enzyme involved in DNA damage repair. By blocking PARG, KSQ-4279 prevents the degradation of poly (ADP-ribose) chains, thereby disrupting the DNA repair process and promoting synthetic lethality in tumor cells—especially those with homologous recombination deficiencies. It offers a novel mechanism distinct from PARP inhibitors and is being explored for use in various solid tumors. KSQ-4279 is supplied for research into DNA repair pathways, synthetic lethality strategies, and targeted cancer therapy development.
| CAS Number | 2446480-97-1 |
| Synonyms | 6-(4-cyclopropyl-6-methoxypyrimidin-5-yl)-1-[[4-[1-propan-2-yl-4-(trifluoromethyl)imidazol-2-yl]phenyl]methyl]pyrazolo[3,4-d]pyrimidine |
| Molecular Formula | C27H25F3N8O |
| Purity | ≥95% |
| IUPAC Name | 6-(4-cyclopropyl-6-methoxypyrimidin-5-yl)-1-[[4-[1-propan-2-yl-4-(trifluoromethyl)imidazol-2-yl]phenyl]methyl]pyrazolo[3,4-d]pyrimidine |
| InChI | InChI=1S/C27H25F3N8O/c1-15(2)37-13-20(27(28,29)30)35-24(37)18-6-4-16(5-7-18)12-38-25-19(11-34-38)10-31-23(36-25)21-22(17-8-9-17)32-14-33-26(21)39-3/h4-7,10-11,13-15,17H,8-9,12H2,1-3H3 |
| InChIKey | KCBWAFJCKVKYHO-UHFFFAOYSA-N |
| SMILES | CC(C)N1C=C(N=C1C2=CC=C(C=C2)CN3C4=NC(=NC=C4C=N3)C5=C(N=CN=C5OC)C6CC6)C(F)(F)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
