For research use only. Not for therapeutic Use.
KRM-III（Cat No.:I030164）is a synthetic peptide-based compound designed to mimic the neuroprotective effects of activity-dependent neurotrophic factor (ADNF). It exhibits potent antioxidant and anti-apoptotic properties, making it a promising candidate for treating neurodegenerative conditions such as Alzheimer’s disease and Parkinson’s disease. KRM-III functions by reducing oxidative stress, preserving mitochondrial integrity, and inhibiting neuronal cell death. Preclinical studies have shown that KRM-III improves cognitive function and protects neurons against toxic insults. Its stability, efficacy, and blood-brain barrier permeability make it valuable for developing therapeutic strategies in central nervous system disorders.
| CAS Number | 79220-94-3 |
| Synonyms | 3,5-diphenyl-1H-imidazole-2-thione |
| Molecular Formula | C15H12N2S |
| Purity | ≥95% |
| IUPAC Name | 3,5-diphenyl-1H-imidazole-2-thione |
| InChI | InChI=1S/C15H12N2S/c18-15-16-14(12-7-3-1-4-8-12)11-17(15)13-9-5-2-6-10-13/h1-11H,(H,16,18) |
| InChIKey | QKOAQVKXZJFMET-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CN(C(=S)N2)C3=CC=CC=C3 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
