For research use only. Not for therapeutic Use.
KPH2f（Cat No.:I044054）is a selective inhibitor of the NEDD8-activating enzyme (NAE), a key regulator of the neddylation pathway involved in protein degradation via cullin-RING ligases (CRLs). By blocking NAE activity, KPH2f disrupts the neddylation of cullin proteins, leading to impaired CRL function and accumulation of cell cycle and survival regulators. This compound is particularly valuable in cancer research, where abnormal neddylation contributes to tumor growth and survival. KPH2f supports studies on ubiquitin-like modifications, protein homeostasis, and the therapeutic targeting of the neddylation pathway in malignancies and proliferative disorders.
| CAS Number | 2760615-09-4 |
| Synonyms | sodium;2-[[3-[(4-cyanonaphthalen-1-yl)amino]pyridin-4-yl]sulfanylmethyl]benzoate |
| Molecular Formula | C24H16N3NaO2S |
| Purity | ≥95% |
| IUPAC Name | sodium;2-[[3-[(4-cyanonaphthalen-1-yl)amino]pyridin-4-yl]sulfanylmethyl]benzoate |
| InChI | InChI=1S/C24H17N3O2S.Na/c25-13-16-9-10-21(20-8-4-3-6-18(16)20)27-22-14-26-12-11-23(22)30-15-17-5-1-2-7-19(17)24(28)29;/h1-12,14,27H,15H2,(H,28,29);/q;+1/p-1 |
| InChIKey | VFQCYGPPRZHSKX-UHFFFAOYSA-M |
| SMILES | C1=CC=C(C(=C1)CSC2=C(C=NC=C2)NC3=CC=C(C4=CC=CC=C43)C#N)C(=O)[O-].[Na+] |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
