For research use only. Not for therapeutic Use.
Kobusin（Cat No.:R032853）is a naturally occurring neolignan compound isolated from various medicinal plants, particularly those in the Magnolia and Schisandra genera. Structurally composed of two phenylpropanoid units, Kobusin exhibits a range of biological activities, including antioxidant, anti-inflammatory, and anticancer properties. It acts by scavenging reactive oxygen species and modulating signaling pathways such as NF-κB and MAPK. Kobusin has also been studied for its potential neuroprotective and antimicrobial effects. As a plant-derived bioactive molecule, it holds promise in the development of natural therapeutics and contributes to the pharmacological value of traditional herbal medicine.
| CAS Number | 36150-23-9 |
| Synonyms | 5-[(3S,3aR,6S,6aR)-6-(3,4-dimethoxyphenyl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-3-yl]-1,3-benzodioxole |
| Molecular Formula | C21H22O6 |
| Purity | ≥95% |
| IUPAC Name | 5-[(3S,3aR,6S,6aR)-6-(3,4-dimethoxyphenyl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-3-yl]-1,3-benzodioxole |
| InChI | InChI=1S/C21H22O6/c1-22-16-5-3-12(7-18(16)23-2)20-14-9-25-21(15(14)10-24-20)13-4-6-17-19(8-13)27-11-26-17/h3-8,14-15,20-21H,9-11H2,1-2H3/t14-,15-,20+,21+/m0/s1 |
| InChIKey | AWOGQCSIVCQXBT-VUEDXXQZSA-N |
| SMILES | COC1=C(C=C(C=C1)[C@@H]2[C@H]3CO[C@@H]([C@H]3CO2)C4=CC5=C(C=C4)OCO5)OC |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
