For research use only. Not for therapeutic Use.
KM91104（Cat No.:R040343）is a potent small-molecule inhibitor of tubulin polymerization, disrupting microtubule dynamics essential for mitotic spindle formation and cell division. By binding to tubulin, KM91104 induces cell cycle arrest at the G2/M phase, leading to apoptosis in rapidly proliferating cells, making it particularly valuable in anticancer research. It has shown efficacy in preclinical models of solid tumors and hematologic malignancies, especially where microtubule integrity is a therapeutic target. KM91104 supports the development of microtubule-targeted agents and is used to study mitotic checkpoint control and cytoskeletal organization in cancer biology.
| CAS Number | 304481-60-5 |
| Synonyms | 3,4-dihydroxy-N-[(E)-(2-hydroxyphenyl)methylideneamino]benzamide |
| Molecular Formula | C14H12N2O4 |
| Purity | ≥95% |
| IUPAC Name | 3,4-dihydroxy-N-[(2-hydroxyphenyl)methylideneamino]benzamide |
| InChI | InChI=1S/C14H12N2O4/c17-11-4-2-1-3-10(11)8-15-16-14(20)9-5-6-12(18)13(19)7-9/h1-8,17-19H,(H,16,20) |
| InChIKey | GWVYHPUGEQGQSF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C=NNC(=O)C2=CC(=C(C=C2)O)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
