For research use only. Not for therapeutic Use.
KL201（Cat No.:I045302）is a small-molecule modulator that selectively stabilizes the interaction between the cryptochrome 1 (CRY1) protein and its partners, thereby influencing the circadian clock. By enhancing CRY1 activity, KL201 extends circadian period length and alters the expression of clock-controlled genes involved in metabolism, hormone regulation, and cellular homeostasis. This makes it a valuable research tool for studying circadian biology and its links to diseases such as sleep disorders, metabolic syndrome, and cancer. KL201’s specificity for CRY1 over CRY2 enables precise mechanistic studies and potential therapeutic exploration targeting circadian rhythm regulation.
| CAS Number | 302939-48-6 |
| Molecular Formula | C17H14BrN3OS |
| Purity | ≥95% |
| IUPAC Name | 2-bromo-N-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)benzamide |
| InChI | InChI=1S/C17H14BrN3OS/c18-12-7-3-1-5-10(12)16(22)21-15-14-11-6-2-4-8-13(11)23-17(14)20-9-19-15/h1,3,5,7,9H,2,4,6,8H2,(H,19,20,21,22) |
| InChIKey | KFSLRFWIPVMBNT-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C1)C3=C(N=CN=C3S2)NC(=O)C4=CC=CC=C4Br |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
