For research use only. Not for therapeutic Use.
KIN101(CAT: I045990) is a potent broad-spectrum RNA virus inhibitor and an isoflavone agonist of IRF-3–dependent signaling. It induces IRF-3 nuclear translocation, leading to increased expression of ISGs and antiviral proteins such as RIG-I and MDA5. KIN101 inhibits viral replication with IC₅₀ = 2 μM (influenza virus) and >5 μM (dengue virus), and significantly reduces HCV RNA levels (>1 log decrease at 10 μM). It also decreases influenza NP protein abundance and suppresses foci formation with an IC₅₀ of 0.2 μM. By targeting innate immune pathways, KIN101 is a valuable tool for antiviral research and drug discovery.
| CAS Number | 610753-87-2 |
| Synonyms | [3-(4-bromophenyl)-4-oxochromen-7-yl] methanesulfonate |
| Molecular Formula | C16H11BrO5S |
| Purity | ≥95% |
| IUPAC Name | [3-(4-bromophenyl)-4-oxochromen-7-yl] methanesulfonate |
| InChI | InChI=1S/C16H11BrO5S/c1-23(19,20)22-12-6-7-13-15(8-12)21-9-14(16(13)18)10-2-4-11(17)5-3-10/h2-9H,1H3 |
| InChIKey | SJGDYHHAYHRLNC-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)OC1=CC2=C(C=C1)C(=O)C(=CO2)C3=CC=C(C=C3)Br |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
