For research use only. Not for therapeutic Use.
KCC009(Cat No.:I007484)is a selective small molecule inhibitor designed to target specific proteins involved in cellular signaling pathways, particularly those linked to cancer cell growth and survival. It has shown promise in preclinical studies for its ability to disrupt tumor progression by inhibiting key kinases or receptors that regulate critical cellular functions. KCC009 has potential therapeutic applications in cancer research, particularly in targeting cancers with aberrant signaling pathways. Its high specificity and potency make it a valuable tool for exploring new treatments and advancing the development of targeted cancer therapies.
| CAS Number | 744198-19-4 |
| Synonyms | benzyl N-[(2S)-1-[(3-bromo-4,5-dihydro-1,2-oxazol-5-yl)methylamino]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]carbamate |
| Molecular Formula | C21H22BrN3O5 |
| Purity | ≥95% |
| IUPAC Name | benzyl N-[(2S)-1-[(3-bromo-4,5-dihydro-1,2-oxazol-5-yl)methylamino]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]carbamate |
| InChI | InChI=1S/C21H22BrN3O5/c22-19-11-17(30-25-19)12-23-20(27)18(10-14-6-8-16(26)9-7-14)24-21(28)29-13-15-4-2-1-3-5-15/h1-9,17-18,26H,10-13H2,(H,23,27)(H,24,28)/t17?,18-/m0/s1 |
| InChIKey | MRULUIQNANUWTK-ZVAWYAOSSA-N |
| SMILES | C1C(ON=C1Br)CNC(=O)[C@H](CC2=CC=C(C=C2)O)NC(=O)OCC3=CC=CC=C3 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |