For research use only. Not for therapeutic Use.
Kauran-16,17-diol（Cat No.:M087079）is a diterpenoid compound belonging to the kaurane family, commonly found in various medicinal plants such as species of Stevia and Croton. It features hydroxyl groups at the 16 and 17 positions, contributing to its bioactivity. This compound has drawn attention for its potential anti-inflammatory, antimicrobial, and cytotoxic properties. Kauran-16,17-diol is under investigation for its role in modulating cellular signaling and immune responses. Its natural origin and diverse pharmacological potential make it a valuable target in the study of plant-derived bioactive compounds for therapeutic development and drug discovery.
| CAS Number | 16836-31-0 |
| Synonyms | (1S,4R,9R,10R,13S,14R)-14-(hydroxymethyl)-5,5,9-trimethyltetracyclo[11.2.1.01,10.04,9]hexadecan-14-ol |
| Molecular Formula | C20H34O2 |
| Purity | ≥95% |
| IUPAC Name | (1S,4R,9R,10R,13S,14R)-14-(hydroxymethyl)-5,5,9-trimethyltetracyclo[11.2.1.01,10.04,9]hexadecan-14-ol |
| InChI | InChI=1S/C20H34O2/c1-17(2)8-4-9-18(3)15(17)7-10-19-11-14(5-6-16(18)19)20(22,12-19)13-21/h14-16,21-22H,4-13H2,1-3H3/t14-,15+,16-,18+,19-,20-/m0/s1 |
| InChIKey | LCYWCTWYVKIBSA-ZYLYKIMZSA-N |
| SMILES | C[C@@]12CCCC([C@H]1CC[C@]34[C@H]2CC[C@@H](C3)[C@](C4)(CO)O)(C)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
