For research use only. Not for therapeutic Use.
KAT Modulator-1(CAT: I040792) is a small-molecule compound that modulates the activity of lysine acetyltransferases (KATs), enzymes responsible for the acetylation of histone and non-histone proteins. By altering KAT activity, KAT Modulator-1 influences chromatin structure and gene transcription, making it a valuable tool in epigenetics research. This compound can regulate gene expression pathways involved in cell cycle control, differentiation, and disease progression, including cancer and inflammatory disorders. KAT Modulator-1 is widely used to study acetylation-dependent signaling and to explore the therapeutic potential of targeting KATs in various biological and pathological contexts.
| CAS Number | 1314006-43-3 |
| Synonyms | 3-pentadecylidenepentane-2,4-dione |
| Molecular Formula | C20H36O2 |
| Purity | ≥95% |
| IUPAC Name | 3-pentadecylidenepentane-2,4-dione |
| InChI | InChI=1S/C20H36O2/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20(18(2)21)19(3)22/h17H,4-16H2,1-3H3 |
| InChIKey | IHNCRYVYEGKPQM-UHFFFAOYSA-N |
| SMILES | CCCCCCCCCCCCCCC=C(C(=O)C)C(=O)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
