For research use only. Not for therapeutic Use.
KA2507（Cat No.:I044472）is a selective small-molecule inhibitor of histone deacetylase 6 (HDAC6), an enzyme involved in deacetylating non-histone proteins such as α-tubulin and Hsp90, which regulate cellular processes including protein degradation, cytoskeletal dynamics, and stress responses. By targeting HDAC6, KA2507 enhances acetylation of its substrates, disrupting cancer cell survival and promoting apoptosis while sparing histone acetylation, thus minimizing off-target effects. It has shown promise in preclinical models of hematologic and solid tumors. KA2507 supports research into epigenetic modulation and targeted cancer therapies with improved safety profiles over pan-HDAC inhibitors.
| CAS Number | 1636894-46-6 |
| Synonyms | 4-[[di(pyrazin-2-yl)amino]methyl]-N-hydroxybenzamide |
| Molecular Formula | C16H14N6O2 |
| Purity | ≥95% |
| IUPAC Name | 4-[[di(pyrazin-2-yl)amino]methyl]-N-hydroxybenzamide |
| InChI | InChI=1S/C16H14N6O2/c23-16(21-24)13-3-1-12(2-4-13)11-22(14-9-17-5-7-19-14)15-10-18-6-8-20-15/h1-10,24H,11H2,(H,21,23) |
| InChIKey | LXHMTDHBMRZSHJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CN(C2=NC=CN=C2)C3=NC=CN=C3)C(=O)NO |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
