For research use only. Not for therapeutic Use.
JY-2（Cat No.:I041290）is a promising investigational compound designed to target specific molecular pathways involved in cancer cell survival and proliferation. It functions by inhibiting key proteins that contribute to tumor growth, particularly in solid tumors. Preclinical studies have demonstrated that JY-2 can effectively suppress the growth of cancer cells by disrupting critical signaling pathways, leading to enhanced tumor cell apoptosis and reduced metastasis. With its targeted mechanism of action, JY-2 shows potential as a new therapeutic option in oncology, offering hope for improved outcomes in patients with difficult-to-treat cancers.
| CAS Number | 339103-05-8 |
| Synonyms | 5-(2,4-dichlorophenyl)-3-pyridin-2-yl-1,2,4-oxadiazole |
| Molecular Formula | C13H7Cl2N3O |
| Purity | ≥95% |
| IUPAC Name | 5-(2,4-dichlorophenyl)-3-pyridin-2-yl-1,2,4-oxadiazole |
| InChI | InChI=1S/C13H7Cl2N3O/c14-8-4-5-9(10(15)7-8)13-17-12(18-19-13)11-3-1-2-6-16-11/h1-7H |
| InChIKey | WBMHQMQALJDGHI-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C2=NOC(=N2)C3=C(C=C(C=C3)Cl)Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
