For research use only. Not for therapeutic Use.
Juglanin(Cat No.:R051172) is a naturally occurring flavonoid with diverse pharmacological properties. It acts as a JNK (c-Jun N-terminal kinase) activator, displaying both anti-inflammatory and antitumor effects. In human breast cancer cells, juglans induces apoptosis, promote programmed cell death, and trigger autophagy, a cellular process for the self-degradation of damaged components. These actions make juglans a promising candidate for potential therapeutic applications in cancer treatment due to their ability to regulate cell survival and death pathways in breast cancer cells.
CAS Number | 5041-67-8 |
Molecular Formula | C20H18O10 |
Purity | ≥95% |
Target | Apoptosis |
Storage | -20°C |
IUPAC Name | 3-[(2S,3R,4R,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]oxy-5,7-dihydroxy-2-(4-hydroxyphenyl)chromen-4-one |
InChI | InChI=1S/C20H18O10/c21-7-13-15(25)17(27)20(29-13)30-19-16(26)14-11(24)5-10(23)6-12(14)28-18(19)8-1-3-9(22)4-2-8/h1-6,13,15,17,20-25,27H,7H2/t13-,15-,17+,20-/m0/s1 |
InChIKey | POQICXMTUPVZMX-UXYNSRGZSA-N |
SMILES | C1=CC(=CC=C1C2=C(C(=O)C3=C(C=C(C=C3O2)O)O)OC4C(C(C(O4)CO)O)O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |