For research use only. Not for therapeutic Use.
JNJ-1289（Cat No.:I043302）is a selective small molecule inhibitor being developed by Janssen Pharmaceuticals for the treatment of various cancers. It targets a specific protein kinase involved in tumor growth and progression. By inhibiting this kinase, JNJ-1289 aims to disrupt the signaling pathways that cancer cells rely on for survival and proliferation. This compound is being investigated in clinical trials to assess its safety, efficacy, and potential as part of targeted therapy regimens for cancers such as solid tumors or hematological malignancies, offering a promising approach in cancer treatment.
| CAS Number | 792898-18-1 |
| Synonyms | 4-[(4-imidazo[1,2-a]pyridin-3-yl-1,3-thiazol-2-yl)amino]phenol |
| Molecular Formula | C16H12N4OS |
| Purity | ≥95% |
| IUPAC Name | 4-[(4-imidazo[1,2-a]pyridin-3-yl-1,3-thiazol-2-yl)amino]phenol |
| InChI | InChI=1S/C16H12N4OS/c21-12-6-4-11(5-7-12)18-16-19-13(10-22-16)14-9-17-15-3-1-2-8-20(14)15/h1-10,21H,(H,18,19) |
| InChIKey | NAJHZKDVMWYLOU-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC=C(N2C=C1)C3=CSC(=N3)NC4=CC=C(C=C4)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
