For research use only. Not for therapeutic Use.
JCN037（Cat No.:I015199）is a potent, selective, small-molecule inhibitor of the RET receptor tyrosine kinase, a critical driver in certain cancers including non-small cell lung cancer and medullary thyroid carcinoma. RET fusions and activating mutations lead to aberrant signaling through pathways such as MAPK/ERK and PI3K/Akt, driving tumor progression and therapeutic resistance. JCN037 effectively suppresses RET phosphorylation and downstream signaling, providing a valuable tool for studying RET-driven oncogenesis and evaluating resistance mechanisms. It is widely applied in cancer biology and targeted therapy research.
| CAS Number | 2305154-31-6 |
| Synonyms | N-(3-bromo-2-fluorophenyl)-7,8-dihydro-[1,4]dioxino[2,3-g]quinazolin-4-amine |
| Molecular Formula | C16H11BrFN3O2 |
| Purity | ≥95% |
| IUPAC Name | N-(3-bromo-2-fluorophenyl)-7,8-dihydro-[1,4]dioxino[2,3-g]quinazolin-4-amine |
| InChI | InChI=1S/C16H11BrFN3O2/c17-10-2-1-3-11(15(10)18)21-16-9-6-13-14(23-5-4-22-13)7-12(9)19-8-20-16/h1-3,6-8H,4-5H2,(H,19,20,21) |
| InChIKey | MTLUFWWVOINWEL-UHFFFAOYSA-N |
| SMILES | C1COC2=C(O1)C=C3C(=C2)N=CN=C3NC4=C(C(=CC=C4)Br)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
