For research use only. Not for therapeutic Use.
Jasmonic Acid-Isoleucine (JA-Ile) is a bioactive conjugate of the plant hormone jasmonic acid and the amino acid isoleucine. It plays a crucial role in plant defense responses, growth regulation, and stress signaling. As the most active form of jasmonates, JA-Ile is essential for activating gene expression involved in plant immunity, particularly against herbivores and pathogens. It also regulates processes such as reproductive development and secondary metabolite production. The formation of Jasmonic Acid-Isoleucine triggers a cascade of molecular events that enhance a plant’s ability to adapt to environmental stress, making it a key focus in agricultural and plant biology research.
CAS Number | 120330-93-0 |
Synonyms | JA-Ile |
Molecular Formula | C18H29NO4 |
Purity | ≥95% |
Target | Endogenous Metabolite |
Storage | -20°C |
IUPAC Name | (2S,3S)-3-methyl-2-[[2-[(1R,2R)-3-oxo-2-[(Z)-pent-2-enyl]cyclopentyl]acetyl]amino]pentanoic acid |
InChI | InChI=1S/C18H29NO4/c1-4-6-7-8-14-13(9-10-15(14)20)11-16(21)19-17(18(22)23)12(3)5-2/h6-7,12-14,17H,4-5,8-11H2,1-3H3,(H,19,21)(H,22,23)/b7-6-/t12-,13+,14+,17-/m0/s1 |
InChIKey | IBZYPBGPOGJMBF-QRHMYKSGSA-N |
SMILES | CCC=CCC1C(CCC1=O)CC(=O)NC(C(C)CC)C(=O)O |