Jasmonic acid-isoleucine (JA-Ile) is a plant hormone formed by the conjugation of jasmonic acid (Item No. <span class=/itemid/>88300</span>) and the amino acid isoleucine. It contributes to several aspects of plant growth and development. JA-Ile signals through a co-receptor complex composed of JAZ repressor proteins and an E1 ubiquitin ligase complex containing the F-box Coronatine Insensitive 1 (COI1). Activation of the COI1-JAZ complex directs the degradation of the JAZ protein, resulting in the release of transcription factors bound and inhibited by JAZ.
| Catalog Number | R049606 |
| CAS Number | 120330-93-0 |
| Synonyms | JA-Ile |
| Molecular Formula | C18H29NO4 |
| Purity | 95% |
| Storage | -20°C |
| IUPAC Name | (2S,3S)-3-methyl-2-[[2-[(1R,2R)-3-oxo-2-[(Z)-pent-2-enyl]cyclopentyl]acetyl]amino]pentanoic acid |
| InChI | InChI=1S/C18H29NO4/c1-4-6-7-8-14-13(9-10-15(14)20)11-16(21)19-17(18(22)23)12(3)5-2/h6-7,12-14,17H,4-5,8-11H2,1-3H3,(H,19,21)(H,22,23)/b7-6-/t12-,13+,14+,17-/m0/s1 |
| InChIKey | IBZYPBGPOGJMBF-QRHMYKSGSA-N |
| SMILES | CCC=CCC1C(CCC1=O)CC(=O)NC(C(C)CC)C(=O)O |
| Reference | 1.Katsir, L.,Chung, H.S.,Koo, A.J.K., et al. Jasmonate signaling: A conserved mechanism of hormone sensing. Curr. Opin. Plant Biol. 11(4), 428-435 (2008). |
