For research use only. Not for therapeutic Use.
Isoscopoletin(Cat No.:R007477)is a naturally occurring coumarin derivative with diverse pharmacological properties. Found in various plants, it exhibits significant antioxidant, anti-inflammatory, and antimicrobial activities. Isoscopoletin is known to scavenge free radicals and modulate inflammatory pathways, making it a promising candidate for managing oxidative stress-related disorders. Additionally, it has shown potential in inhibiting microbial growth and supporting immune system functions. With applications in traditional medicine and modern pharmacological research, isoscopoletin continues to be explored for its therapeutic potential in treating cardiovascular, metabolic, and neurodegenerative diseases. Its natural origin enhances its appeal in medicinal studies.
CAS Number | 776-86-3 |
Molecular Formula | C10H8O4 |
Purity | ≥95% |
Target | HBV |
Storage | -20°C |
IUPAC Name | 6-hydroxy-7-methoxychromen-2-one |
InChI | InChI=1S/C10H8O4/c1-13-9-5-8-6(4-7(9)11)2-3-10(12)14-8/h2-5,11H,1H3 |
InChIKey | SYTYLPHCLSSCOJ-UHFFFAOYSA-N |
SMILES | COC1=C(C=C2C=CC(=O)OC2=C1)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |