For research use only. Not for therapeutic Use.
Isopropylhydrazine hydrochloride (Cat No.: R053733) is the hydrochloride salt of isopropylhydrazine, with the molecular formula C₃H₁₀ClN₂. It features a hydrazine moiety substituted with an isopropyl group, forming a basic, nitrogen-rich compound. The hydrochloride form enhances its stability and solubility in water, making it suitable for use in organic synthesis. It serves as an intermediate in the preparation of pharmaceuticals, agrochemicals, and heterocyclic compounds. Its nucleophilic and reductive properties make it valuable in forming hydrazones, diazotization reactions, and various functional group transformations.
| CAS Number | 16726-41-3 |
| Synonyms | (1-Methylethyl)hydrazine Monohydrochloride |
| Molecular Formula | C3H11ClN2 |
| Purity | ≥95% |
| Storage | Store at -20℃ |
| IUPAC Name | propan-2-ylhydrazine;hydrochloride |
| InChI | InChI=1S/C3H10N2.ClH/c1-3(2)5-4;/h3,5H,4H2,1-2H3;1H |
| InChIKey | ILULYDJFTJKQAP-UHFFFAOYSA-N |
| SMILES | CC(C)NN.Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |