Isopropyl nitrite(Cat No.:M010349) is a chemical compound that belongs to the class of alkyl nitrites. It is a volatile, colorless liquid commonly used as a vasodilator, which means it can relax and dilate blood vessels to increase blood flow. This property makes it useful in certain medical scenarios, though it is more commonly recognized for its recreational use, where it is inhaled for its euphoric and muscle-relaxing effects. Isopropyl nitrite also acts as a potent source of nitric oxide, which can have various biological effects including smooth muscle relaxation.
Catalog Number | M010349 |
CAS Number | 541-42-4 |
Synonyms | ISOPROPYL NITRITE;Isopropyl nitritel;1-Methyl ethyl ester nitrous acid;1-methylethylnitrite;2-propanolnitrite;isopropylesterkyselinydusite;nitrousacid,1-methylethylester;nitrousacid,isopropylester |
Molecular Formula | C3H7NO2 |
Purity | 95% |
Storage | -20°C |
IUPAC Name | propan-2-yl nitrite |
InChI | InChI=1S/C3H7NO2/c1-3(2)6-4-5/h3H,1-2H3 |
InChIKey | SKRDXYBATCVEMS-UHFFFAOYSA-N |
SMILES | CC(C)ON=O |